Difference between revisions of "CPD-7649"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-N6-lipoyllysine == * common-name: ** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) * inchi-key: ** nzkryjgnypyxjz-u...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7649 == |
* common-name: | * common-name: | ||
− | ** | + | ** dopamine 3-o-sulfate |
+ | * smiles: | ||
+ | ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) | ||
+ | * inchi-key: | ||
+ | ** nzkryjgnypyxjz-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 233.239 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN6666-9]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dopamine 3-o-sulfate}} |
+ | {{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=233.239}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7649
- common-name:
- dopamine 3-o-sulfate
- smiles:
- c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
- inchi-key:
- nzkryjgnypyxjz-uhfffaoysa-n
- molecular-weight:
- 233.239