Difference between revisions of "CPD-7733"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBON-MONOXIDE == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] * inchi-key: ** ugfairiumavxcw-uhfffaoysa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7733 == |
* common-name: | * common-name: | ||
| − | ** | + | ** aurachin c |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fihxchbehlcxeg-yefhwucqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 379.541 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15029]] | ||
| + | * [[RXN-17335]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=aurachin c}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fihxchbehlcxeg-yefhwucqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=379.541}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-7733
- common-name:
- aurachin c
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o)
- inchi-key:
- fihxchbehlcxeg-yefhwucqsa-n
- molecular-weight:
- 379.541
