Difference between revisions of "CPD-782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12729 RXN-12729] == * direction: ** left-to-right * common-name: ** β l-selenocystathionas...")
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12729 RXN-12729] ==
+
== Metabolite CPD-782 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** β l-selenocystathionase
+
** 3,4-dihydroxyphenylacetate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.4.1.8 ec-4.4.1.8]
+
** c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-13717]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[SELENOHOMOCYSTEINE]][c]
+
** cffzdzcdufsofz-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20949]]
+
** 167.141
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN6666-5]]
−
* [[PWY-6936]], seleno-amino acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936]
+
== Reaction(s) of unknown directionality ==
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=3,4-dihydroxyphenylacetate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=167.141}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=β l-selenocystathionase}}
 
−
{{#set: ec-number=ec-4.4.1.8}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-782

  • common-name:
    • 3,4-dihydroxyphenylacetate
  • smiles:
    • c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
  • inchi-key:
    • cffzdzcdufsofz-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-782&oldid=139764"