Difference between revisions of "CPD-782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8629 RXN-8629] == * direction: ** reversible * common-name: ** h-gcv-protein-(dihydrolipoyl)lys...")
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8629 RXN-8629] ==
+
== Metabolite CPD-782 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** h-gcv-protein-(dihydrolipoyl)lysine:nad+ oxidoreductase
+
** 3,4-dihydroxyphenylacetate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.8.1.4 ec-1.8.1.4]
+
** c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[DIHYDROLIPOYL-GCVH]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[PROTEIN-LIPOYLLYSINE]][c] '''+''' 1 [[PROTON]][c]
+
** cffzdzcdufsofz-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10661]]
+
** 167.141
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ03718]]
+
* [[RXN6666-5]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=3,4-dihydroxyphenylacetate}}
−
* Gene: [[SJ13629]]
+
{{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=167.141}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ06474]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[GLYCLEAV-PWY]], glycine cleavage: [http://metacyc.org/META/NEW-IMAGE?object=GLYCLEAV-PWY GLYCLEAV-PWY]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=h-gcv-protein-(dihydrolipoyl)lysine:nad+ oxidoreductase}}
 
−
{{#set: ec-number=ec-1.8.1.4}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-782

  • common-name:
    • 3,4-dihydroxyphenylacetate
  • smiles:
    • c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
  • inchi-key:
    • cffzdzcdufsofz-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-782&oldid=139764"