Difference between revisions of "CPD-782"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IPC == * common-name: ** an inositol-phospho-α hydroxyphytoceramide == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-782 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,4-dihydroxyphenylacetate |
+ | * smiles: | ||
+ | ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) | ||
+ | * inchi-key: | ||
+ | ** cffzdzcdufsofz-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 167.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN6666-5]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylacetate}} |
+ | {{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=167.141}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-782
- common-name:
- 3,4-dihydroxyphenylacetate
- smiles:
- c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
- inchi-key:
- cffzdzcdufsofz-uhfffaoysa-m
- molecular-weight:
- 167.141