Difference between revisions of "CPD-782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8158 == * common-name: ** 1-palmitoyl-2-linoleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)...")
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8158 ==
+
== Metabolite CPD-782 ==
 
* common-name:
 
* common-name:
** 1-palmitoyl-2-linoleoyl-phosphatidylcholine
+
** 3,4-dihydroxyphenylacetate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
+
** c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
 
* inchi-key:
 
* inchi-key:
** jlpulhdhaoznqi-ztimhpmxsa-n
+
** cffzdzcdufsofz-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 758.07
+
** 167.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12430]]
 
* [[RXN-8361]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8360]]
+
* [[RXN6666-5]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-palmitoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=3,4-dihydroxyphenylacetate}}
{{#set: inchi-key=inchikey=jlpulhdhaoznqi-ztimhpmxsa-n}}
+
{{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}}
{{#set: molecular-weight=758.07}}
+
{{#set: molecular-weight=167.141}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-782

  • common-name:
    • 3,4-dihydroxyphenylacetate
  • smiles:
    • c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
  • inchi-key:
    • cffzdzcdufsofz-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality