Difference between revisions of "CPD-782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite CPD-2186 == * common-name: ** 1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(=o)occ(oc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19169 ==
+
== Metabolite CPD-2186 ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-octadecenoyl-coa
+
** 1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** aveyykdekgjvbu-bpmmelmssa-j
+
** dsofjfhiqqefsk-xvncuxiasa-m
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 741.961
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17778]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17777]]
+
* [[RXN-1727]]
 +
* [[RXN-8319]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
+
{{#set: inchi-key=inchikey=dsofjfhiqqefsk-xvncuxiasa-m}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=741.961}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-2186

  • common-name:
    • 1-α-linolenoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • dsofjfhiqqefsk-xvncuxiasa-m
  • molecular-weight:
    • 741.961

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality