Difference between revisions of "CPD-787"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...") |
||
| (4 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-787 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate |
* smiles: | * smiles: | ||
| − | ** c([o-])(=o) | + | ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zbcbetmbsdtinl-nwjcxacmsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 170.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1K-87]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.121}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-787
- common-name:
- (2z,4z)-2-hydroxyhepta-2,4-dienedioate
- smiles:
- c([o-])(=o)cc=cc=c(o)c(=o)[o-]
- inchi-key:
- zbcbetmbsdtinl-nwjcxacmsa-l
- molecular-weight:
- 170.121
