Difference between revisions of "CPD-787"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-ALDOLASE-RXN THREONINE-ALDOLASE-RXN] == * direction: ** left-to-right * common-name: ** t...")
 
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-ALDOLASE-RXN THREONINE-ALDOLASE-RXN] ==
+
== Metabolite CPD-787 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** threonine aldolase
+
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.2.48 ec-4.1.2.48]
+
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
−
** [http://enzyme.expasy.org/EC/4.1.2.5 ec-4.1.2.5]
+
* inchi-key:
−
== Reaction formula ==
+
** zbcbetmbsdtinl-nwjcxacmsa-l
−
* 1 [[THR]][c] '''=>''' 1 [[ACETALD]][c] '''+''' 1 [[GLY]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 170.121
−
* Gene: [[SJ12304]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN1K-87]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
−
* Gene: [[SJ06446]]
+
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=170.121}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5436]], L-threonine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5436 PWY-5436]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[GLYSYN-THR-PWY]], glycine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-THR-PWY GLYSYN-THR-PWY]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19626 19626]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00751 R00751]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=threonine aldolase}}
 
−
{{#set: ec-number=ec-4.1.2.5|ec-4.1.2.48}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-787

  • common-name:
    • (2z,4z)-2-hydroxyhepta-2,4-dienedioate
  • smiles:
    • c([o-])(=o)cc=cc=c(o)c(=o)[o-]
  • inchi-key:
    • zbcbetmbsdtinl-nwjcxacmsa-l
  • molecular-weight:
    • 170.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-787&oldid=139593"