Difference between revisions of "CPD-787"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15153 == * common-name: ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c...") |
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRO-DIOH-BENZOATE == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c1(=cc=cc(c1o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** incswykiciyahb-wdskdsinsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 155.13 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DHBDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=(2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=incswykiciyahb-wdskdsinsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.13}} |
Revision as of 15:00, 5 January 2021
Contents
Metabolite DIHYDRO-DIOH-BENZOATE
- common-name:
- (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate
- smiles:
- c([o-])(=o)c1(=cc=cc(c1o)o)
- inchi-key:
- incswykiciyahb-wdskdsinsa-m
- molecular-weight:
- 155.13
