|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-472 RXN66-472] == | + | == Metabolite CPD-787 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** fatty aldehyde dehydrogenase | + | ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate |
| − | ** aldehyde dehydrogenase (nad)
| + | * smiles: |
| − | ** 2-methyl branched fatty aldehyde dehydrogenase
| + | ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] |
| − | * ec-number: | + | * inchi-key: |
| − | ** [http://enzyme.expasy.org/EC/1.2.1.3 ec-1.2.1.3] | + | ** zbcbetmbsdtinl-nwjcxacmsa-l |
| − | == Reaction formula == | + | * molecular-weight: |
| − | * 1 [[2-Me-Branched-234-Sat-FALD]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-Me-Branched-234-Sat-FA]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
| + | ** 170.121 |
| − | == Gene(s) associated with this reaction ==
| + | == Reaction(s) known to consume the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[RXN1K-87]] |
| − | * Gene: [[SJ06359]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}} |
| − | * Gene: [[SJ22552]]
| + | {{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}} |
| − | ** Category: [[annotation]] | + | {{#set: molecular-weight=170.121}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ00435]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ17249]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ10107]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ09287]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ11330]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06470]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ06456]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ11331]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ05897]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06047]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY66-387]], fatty acid α-oxidation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387] | |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=aldehyde dehydrogenase (nad)|2-methyl branched fatty aldehyde dehydrogenase|fatty aldehyde dehydrogenase}} | |
| − | {{#set: ec-number=ec-1.2.1.3}}
| |
| − | {{#set: nb gene associated=12}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
