Difference between revisions of "CPD-8058"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17483 == * transcription-direction: ** positive * right-end-position: ** 43064 * left-end-position: ** 38580 * centisome-position: ** 14.7393675...")
(Created page with "Category:metabolite == Metabolite CPD-8058 == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) * inchi-key: ** rsyncmyd...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17483 ==
+
== Metabolite CPD-8058 ==
* transcription-direction:
+
* common-name:
** positive
+
** d-galactosylononitol
* right-end-position:
+
* smiles:
** 43064
+
** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
* left-end-position:
+
* inchi-key:
** 38580
+
** rsyncmydvzfzbp-nrorzaabsa-n
* centisome-position:
+
* molecular-weight:
** 14.7393675   
+
** 356.326
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-8281]]
* [[3.1.13.4-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=d-galactosylononitol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=356.326}}
{{#set: right-end-position=43064}}
 
{{#set: left-end-position=38580}}
 
{{#set: centisome-position=14.7393675    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8058

  • common-name:
    • d-galactosylononitol
  • smiles:
    • coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
  • inchi-key:
    • rsyncmydvzfzbp-nrorzaabsa-n
  • molecular-weight:
    • 356.326

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality