Difference between revisions of "CPD-8058"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01274 == * transcription-direction: ** negative * right-end-position: ** 21628 * left-end-position: ** 20140 * centisome-position: ** 13.145098...") |
(Created page with "Category:metabolite == Metabolite CPD-8058 == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) * inchi-key: ** rsyncmyd...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8058 == |
− | * | + | * common-name: |
− | ** | + | ** d-galactosylononitol |
− | * | + | * smiles: |
− | ** | + | ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) |
− | * | + | * inchi-key: |
− | ** | + | ** rsyncmydvzfzbp-nrorzaabsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 356.326 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-8281]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=d-galactosylononitol}} | |
− | + | {{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}} | |
− | + | {{#set: molecular-weight=356.326}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8058
- common-name:
- d-galactosylononitol
- smiles:
- coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
- inchi-key:
- rsyncmydvzfzbp-nrorzaabsa-n
- molecular-weight:
- 356.326