Difference between revisions of "CPD-8058"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12199 == * common-name: ** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)...") |
(Created page with "Category:metabolite == Metabolite CPD-8058 == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) * inchi-key: ** rsyncmyd...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8058 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-galactosylononitol |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rsyncmydvzfzbp-nrorzaabsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 356.326 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8281]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-galactosylononitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=356.326}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8058
- common-name:
- d-galactosylononitol
- smiles:
- coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
- inchi-key:
- rsyncmydvzfzbp-nrorzaabsa-n
- molecular-weight:
- 356.326
