Difference between revisions of "CPD-8073"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...")
(Created page with "Category:metabolite == Metabolite XTP == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8347 ==
+
== Metabolite XTP ==
 
* common-name:
 
* common-name:
** 1-18:2-2-lysophosphatidylcholine
+
** xtp
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
* inchi-key:
 
* inchi-key:
** spjfyyjxnpezdw-ftjopakqsa-n
+
** caefewvyezabla-uuokfmhzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 519.657
+
** 520.136
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[NTPD]]
 +
* [[RXN0-1603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12430]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
+
{{#set: common-name=xtp}}
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
+
{{#set: inchi-key=inchikey=caefewvyezabla-uuokfmhzsa-j}}
{{#set: molecular-weight=519.657}}
+
{{#set: molecular-weight=520.136}}

Revision as of 11:15, 15 January 2021

Metabolite XTP

  • common-name:
    • xtp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • caefewvyezabla-uuokfmhzsa-j
  • molecular-weight:
    • 520.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality