Difference between revisions of "CPD-8073"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XYLOSE == * common-name: ** α-d-xylopyranose * smiles: ** c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** srbfzhdqgsbbor-lechcgjusa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2030 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycerophosphoserine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zwzwygmenqvnfu-uhnvwzdzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14136]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycerophosphoserine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.144}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite CPD0-2030
- common-name:
- glycerophosphoserine
- smiles:
- c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
- inchi-key:
- zwzwygmenqvnfu-uhnvwzdzsa-m
- molecular-weight:
- 258.144
