|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LYSINE--TRNA-LIGASE-RXN LYSINE--TRNA-LIGASE-RXN] == | + | == Metabolite CPD-8075 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** lysine-trna ligase | + | ** 1-18:2-2-16:1-monogalactosyldiacylglycerol |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.1.1.6 ec-6.1.1.6] | + | ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[LYS]][c] '''+''' 1 [[LYS-tRNAs]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Charged-LYS-tRNAs]][c] '''+''' 1 [[PPI]][c]
| + | ** hghvcqzwrzwqks-cphkdgevsa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ21008]] | + | ** 753.067 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-8297]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ12237]] | + | {{#set: common-name=1-18:2-2-16:1-monogalactosyldiacylglycerol}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=hghvcqzwrzwqks-cphkdgevsa-n}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=753.067}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ21009]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | |
| − | ** '''21''' reactions found over '''21''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20793 20793]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03658 R03658]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P41258 P41258]
| |
| − | ** [http://www.uniprot.org/uniprot/P46861 P46861]
| |
| − | ** [http://www.uniprot.org/uniprot/P47382 P47382]
| |
| − | ** [http://www.uniprot.org/uniprot/O57963 O57963]
| |
| − | ** [http://www.uniprot.org/uniprot/O51603 O51603]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTT7 Q9JTT7]
| |
| − | ** [http://www.uniprot.org/uniprot/O83650 O83650]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X231 Q9X231]
| |
| − | ** [http://www.uniprot.org/uniprot/P43825 P43825]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZDF8 Q9ZDF8]
| |
| − | ** [http://www.uniprot.org/uniprot/O84786 O84786]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z6X5 Q9Z6X5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CII7 Q9CII7]
| |
| − | ** [http://www.uniprot.org/uniprot/P56126 P56126]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZMP8 Q9ZMP8]
| |
| − | ** [http://www.uniprot.org/uniprot/O67258 O67258]
| |
| − | ** [http://www.uniprot.org/uniprot/O84002 O84002]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RHV9 Q9RHV9]
| |
| − | ** [http://www.uniprot.org/uniprot/P32048 P32048]
| |
| − | ** [http://www.uniprot.org/uniprot/P37879 P37879]
| |
| − | ** [http://www.uniprot.org/uniprot/Q48986 Q48986]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A8N7 P0A8N7]
| |
| − | ** [http://www.uniprot.org/uniprot/P37477 P37477]
| |
| − | ** [http://www.uniprot.org/uniprot/P75500 P75500]
| |
| − | ** [http://www.uniprot.org/uniprot/P95970 P95970]
| |
| − | ** [http://www.uniprot.org/uniprot/P73443 P73443]
| |
| − | ** [http://www.uniprot.org/uniprot/P15180 P15180]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A8N3 P0A8N3]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A8N5 P0A8N5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43776 Q43776]
| |
| − | ** [http://www.uniprot.org/uniprot/O74059 O74059]
| |
| − | ** [http://www.uniprot.org/uniprot/O30522 O30522]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=lysine-trna ligase}} | |
| − | {{#set: ec-number=ec-6.1.1.6}}
| |
| − | {{#set: nb gene associated=3}}
| |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}} | |
