Difference between revisions of "CPD-8076"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22264 == * transcription-direction: ** positive * right-end-position: ** 366888 * left-end-position: ** 356999 * centisome-position: ** 61.268764...")
(Created page with "Category:metabolite == Metabolite CPD-8076 == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ22264 ==
+
== Metabolite CPD-8076 ==
* transcription-direction:
+
* common-name:
** positive
+
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
* right-end-position:
+
* smiles:
** 366888
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
* left-end-position:
+
* inchi-key:
** 356999
+
** syspljxkzrpipm-lwnbrhqxsa-n
* centisome-position:
+
* molecular-weight:
** 61.268764   
+
** 751.052
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-8297]]
* [[6PGLUCONDEHYDROG-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
* [[PYRROLINECARBREDUCT-RXN]]
+
{{#set: molecular-weight=751.052}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-9952]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN66-546]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[P122-PWY]]
 
** '''16''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-3341]]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
* [[PROSYN-PWY]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-6344]]
 
** '''2''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-4981]]
 
** '''3''' reactions found over '''6''' reactions in the full pathway
 
* [[ARG-PRO-PWY]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[OXIDATIVEPENT-PWY]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=366888}}
 
{{#set: left-end-position=356999}}
 
{{#set: centisome-position=61.268764    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8076

  • common-name:
    • 1-18:3-2-16:1-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
  • inchi-key:
    • syspljxkzrpipm-lwnbrhqxsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality