Difference between revisions of "CPD-8076"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10802 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-7828 ** Category:...")
(Created page with "Category:metabolite == Metabolite CPD-8076 == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10802 ==
+
== Metabolite CPD-8076 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
== Reaction(s) associated ==
+
* smiles:
* [[RXN-7828]]
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
** syspljxkzrpipm-lwnbrhqxsa-n
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* molecular-weight:
* [[RXN-8228]]
+
** 751.052
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-8297]]
== Pathway(s) associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5268]]
+
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
** '''1''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
* [[PWY-5139]]
+
{{#set: molecular-weight=751.052}}
** '''1''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-5307]]
 
** '''1''' reactions found over '''6''' reactions in the full pathway
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8076

  • common-name:
    • 1-18:3-2-16:1-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
  • inchi-key:
    • syspljxkzrpipm-lwnbrhqxsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality