Difference between revisions of "CPD-8076"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-valine == * common-name: ** an n-terminal l-valyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-8076 == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8076 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:3-2-16:1-monogalactosyldiacylglycerol |
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o | ||
| + | * inchi-key: | ||
| + | ** syspljxkzrpipm-lwnbrhqxsa-n | ||
| + | * molecular-weight: | ||
| + | ** 751.052 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8297]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}} |
| + | {{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}} | ||
| + | {{#set: molecular-weight=751.052}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-8076
- common-name:
- 1-18:3-2-16:1-monogalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
- inchi-key:
- syspljxkzrpipm-lwnbrhqxsa-n
- molecular-weight:
- 751.052
