Difference between revisions of "CPD-8077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-419 == * common-name: ** o-palmitoyl-l-carnitine * smiles: ** cccccccccccccccc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** xomrrqxk...")
(Created page with "Category:metabolite == Metabolite CPD-8077 == * common-name: ** 1-18:1-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-419 ==
+
== Metabolite CPD-8077 ==
 
* common-name:
 
* common-name:
** o-palmitoyl-l-carnitine
+
** 1-18:1-2-16:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cccccccccccccccc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
+
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** xomrrqxkhmymoc-oaqylsrusa-n
+
** sfkzppodzmclpe-nhgajdlwsa-n
 
* molecular-weight:
 
* molecular-weight:
** 399.613
+
** 753.067
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+
* [[RXN-8303]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-palmitoyl-l-carnitine}}
+
{{#set: common-name=1-18:1-2-16:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=xomrrqxkhmymoc-oaqylsrusa-n}}
+
{{#set: inchi-key=inchikey=sfkzppodzmclpe-nhgajdlwsa-n}}
{{#set: molecular-weight=399.613}}
+
{{#set: molecular-weight=753.067}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8077

  • common-name:
    • 1-18:1-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • sfkzppodzmclpe-nhgajdlwsa-n
  • molecular-weight:
    • 753.067

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality