Difference between revisions of "CPD-8077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17312 == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite CPD-8077 == * common-name: ** 1-18:1-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17312 ==
+
== Metabolite CPD-8077 ==
 
* common-name:
 
* common-name:
** docosahexaenoyl-coa
+
** 1-18:1-2-16:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** menfzxmqsyyvrk-crcgjgbysa-j
+
** sfkzppodzmclpe-nhgajdlwsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1073.981
+
** 753.067
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16063]]
+
* [[RXN-8303]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16063]]
 
* [[RXN-16137]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=docosahexaenoyl-coa}}
+
{{#set: common-name=1-18:1-2-16:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
+
{{#set: inchi-key=inchikey=sfkzppodzmclpe-nhgajdlwsa-n}}
{{#set: molecular-weight=1073.981}}
+
{{#set: molecular-weight=753.067}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8077

  • common-name:
    • 1-18:1-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • sfkzppodzmclpe-nhgajdlwsa-n
  • molecular-weight:
    • 753.067

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality