Difference between revisions of "CPD-8078"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-9152 == * common-name: ** 4-chlorocatechol * smiles: ** c1(c=c(c(=cc=1cl)o)o) * inchi-key: ** wwobypkuyodhdg-uhfffaoysa-n * molecular...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9152 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-chlorocatechol |
* smiles: | * smiles: | ||
− | ** c | + | ** c1(c=c(c(=cc=1cl)o)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wwobypkuyodhdg-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 144.557 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9912]] |
+ | * [[RXN-9914]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-chlorocatechol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wwobypkuyodhdg-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=144.557}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-9152
- common-name:
- 4-chlorocatechol
- smiles:
- c1(c=c(c(=cc=1cl)o)o)
- inchi-key:
- wwobypkuyodhdg-uhfffaoysa-n
- molecular-weight:
- 144.557