Difference between revisions of "CPD-8078"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Long-Chain-3S-Hydroxyacyl-CoAs == * common-name: ** a long-chain (3s)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == *...")
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Long-Chain-3S-Hydroxyacyl-CoAs ==
+
== Metabolite CPD-8078 ==
 
* common-name:
 
* common-name:
** a long-chain (3s)-3-hydroxyacyl-coa
+
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 +
* inchi-key:
 +
** wsmybuvbfwdmec-sbpcighssa-n
 +
* molecular-weight:
 +
** 749.036
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.211-RXN]]
+
* [[RXN-8309]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.211-RXN]]
+
* [[RXN-8299]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a long-chain (3s)-3-hydroxyacyl-coa}}
+
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
 +
{{#set: molecular-weight=749.036}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-8078

  • common-name:
    • 1-18:3-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • wsmybuvbfwdmec-sbpcighssa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality