Difference between revisions of "CPD-8078"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9152 == * common-name: ** 4-chlorocatechol * smiles: ** c1(c=c(c(=cc=1cl)o)o) * inchi-key: ** wwobypkuyodhdg-uhfffaoysa-n * molecular...") |
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8078 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:3-2-16:2-monogalactosyldiacylglycerol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wsmybuvbfwdmec-sbpcighssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 749.036 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8309]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8299]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=749.036}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-8078
- common-name:
- 1-18:3-2-16:2-monogalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
- inchi-key:
- wsmybuvbfwdmec-sbpcighssa-n
- molecular-weight:
- 749.036
