Difference between revisions of "CPD-8078"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13729 RXN-13729] == * direction: ** left-to-right * common-name: ** phytosphingosine 1-phosphat...")
 
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13729 RXN-13729] ==
+
== Metabolite CPD-8078 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phytosphingosine 1-phosphate aldolase
+
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.2.27 ec-4.1.2.27]
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[PHTYOSPHINGOSINE-1-P]][c] '''=>''' 1 [[CPD-14766]][c] '''+''' 1 [[PHOSPHORYL-ETHANOLAMINE]][c]
+
** wsmybuvbfwdmec-sbpcighssa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19063]]
+
** 749.036
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8309]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-8299]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7119]], sphingolipid recycling and degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7119 PWY-7119]
+
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=749.036}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phytosphingosine 1-phosphate aldolase}}
 
−
{{#set: ec-number=ec-4.1.2.27}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-8078

  • common-name:
    • 1-18:3-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • wsmybuvbfwdmec-sbpcighssa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8078&oldid=139778"