Difference between revisions of "CPD-8078"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * smiles: ** c(o)c2(=nc1(c(=o)nc(n)=nc=1...") |
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite AMINO- | + | == Metabolite AMINO-PARATHION == |
* common-name: | * common-name: | ||
| − | ** | + | ** amino-parathion |
* smiles: | * smiles: | ||
| − | ** | + | ** ccop(oc1(c=cc(=cc=1)n))(occ)=s |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xizotxgjxstqdi-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 261.275 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=amino-parathion}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=261.275}} |
Revision as of 15:31, 5 January 2021
Contents
Metabolite AMINO-PARATHION
- common-name:
- amino-parathion
- smiles:
- ccop(oc1(c=cc(=cc=1)n))(occ)=s
- inchi-key:
- xizotxgjxstqdi-uhfffaoysa-n
- molecular-weight:
- 261.275
