Difference between revisions of "CPD-8078"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite Core1 == * common-name: ** core 1 == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 2.4...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Core1 == |
* common-name: | * common-name: | ||
| − | ** | + | ** core 1 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.122-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=core 1}} |
| − | |||
| − | |||
Revision as of 13:13, 14 January 2021
Contents
Metabolite Core1
- common-name:
- core 1
