Difference between revisions of "CPD-8079"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Aryl-sulfates == * common-name: ** an aryl sulfate == Reaction(s) known to consume the compound == * ARYLSULFAT-RXN == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite CPD-8079 == * common-name: ** 1-18:1-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Aryl-sulfates ==
+
== Metabolite CPD-8079 ==
 
* common-name:
 
* common-name:
** an aryl sulfate
+
** 1-18:1-2-16:3-monogalactosyldiacylglycerol
 +
* smiles:
 +
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 +
* inchi-key:
 +
** uledcqdcqahgfd-lukloydesa-n
 +
* molecular-weight:
 +
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARYLSULFAT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARYL-SULFOTRANSFERASE-RXN]]
+
* [[RXN-8303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an aryl sulfate}}
+
{{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}}
 +
{{#set: molecular-weight=751.052}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-8079

  • common-name:
    • 1-18:1-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • uledcqdcqahgfd-lukloydesa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality