Difference between revisions of "CPD-8079"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22411 == * transcription-direction: ** positive * right-end-position: ** 59109 * left-end-position: ** 45285 * centisome-position: ** 25.572464...") |
(Created page with "Category:metabolite == Metabolite CPD-8079 == * common-name: ** 1-18:1-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8079 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-18:1-2-16:3-monogalactosyldiacylglycerol |
| − | * | + | * smiles: |
| − | ** | + | ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** uledcqdcqahgfd-lukloydesa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 751.052 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-8303]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}} | |
| − | + | {{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}} | |
| − | == | + | {{#set: molecular-weight=751.052}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8079
- common-name:
- 1-18:1-2-16:3-monogalactosyldiacylglycerol
- smiles:
- ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
- inchi-key:
- uledcqdcqahgfd-lukloydesa-n
- molecular-weight:
- 751.052
