Difference between revisions of "CPD-8080"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-Aspartates == * common-name: ** a [protein]-l-aspartate == Reaction(s) known to consume the compound == * PEPTIDE-ASPARTATE-B...")
(Created page with "Category:metabolite == Metabolite CPD-8080 == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-L-Aspartates ==
+
== Metabolite CPD-8080 ==
 
* common-name:
 
* common-name:
** a [protein]-l-aspartate
+
** 1-18:2-2-16:3-monogalactosyldiacylglycerol
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 +
* inchi-key:
 +
** dvrkgrmgqjlnpc-nidyupdjsa-n
 +
* molecular-weight:
 +
** 749.036
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
+
* [[RXN-8301]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.5.1.52-RXN]]
+
* [[RXN-8306]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-aspartate}}
+
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}}
 +
{{#set: molecular-weight=749.036}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8080

  • common-name:
    • 1-18:2-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • dvrkgrmgqjlnpc-nidyupdjsa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality