Difference between revisions of "CPD-8081"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYLCHOLINE == * common-name: ** a phosphatidylcholine == Reaction(s) known to consume the compound == * 2.3.1.23-RXN * 2.7...") |
(Created page with "Category:metabolite == Metabolite CPD-8081 == * common-name: ** 1-18:3-2-18:3-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8081 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:3-2-18:3-digalactosyldiacylglycerol |
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o | ||
| + | * inchi-key: | ||
| + | ** kdyapqvyjxuqny-ncuixijtsa-n | ||
| + | * molecular-weight: | ||
| + | ** 937.216 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8311]] |
| − | + | * [[RXN-8314]] | |
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-18:3-digalactosyldiacylglycerol}} |
| + | {{#set: inchi-key=inchikey=kdyapqvyjxuqny-ncuixijtsa-n}} | ||
| + | {{#set: molecular-weight=937.216}} | ||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-8081
- common-name:
- 1-18:3-2-18:3-digalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
- inchi-key:
- kdyapqvyjxuqny-ncuixijtsa-n
- molecular-weight:
- 937.216
