Difference between revisions of "CPD-8086"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
(Created page with "Category:metabolite == Metabolite CPD-8086 == * common-name: ** 1-linoleoyl-2-palmitoyl-phosphatidylglycerol * smiles: ** cccccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11407 ==
+
== Metabolite CPD-8086 ==
 
* common-name:
 
* common-name:
** thyroxine sulfate
+
** 1-linoleoyl-2-palmitoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+
** cccccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** qyxijuzwssqict-lbprgkrzsa-m
+
** iykxcqwbmrybpi-wlgrlvtesa-m
 
* molecular-weight:
 
* molecular-weight:
** 855.924
+
** 745.992
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8317]]
 +
* [[RXN-8318]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10614]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thyroxine sulfate}}
+
{{#set: common-name=1-linoleoyl-2-palmitoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
+
{{#set: inchi-key=inchikey=iykxcqwbmrybpi-wlgrlvtesa-m}}
{{#set: molecular-weight=855.924}}
+
{{#set: molecular-weight=745.992}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-8086

  • common-name:
    • 1-linoleoyl-2-palmitoyl-phosphatidylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • iykxcqwbmrybpi-wlgrlvtesa-m
  • molecular-weight:
    • 745.992

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality