Difference between revisions of "CPD-8088"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09773 == * transcription-direction: ** positive * right-end-position: ** 113469 * left-end-position: ** 104152 * centisome-position: ** 25.631485...")
(Created page with "Category:metabolite == Metabolite CPD-8088 == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09773 ==
+
== Metabolite CPD-8088 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
−
* right-end-position:
+
* smiles:
−
** 113469
+
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
−
* left-end-position:
+
* inchi-key:
−
** 104152
+
** rtazwrzkfstmoy-nmsvecgzsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 25.631485   
+
** 784.107
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8321]]
−
== Reaction(s) associated ==
+
* [[RXN-8328]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-11241]]
+
* [[RXN-8320]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
−
* [[RXN-11267]]
+
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=784.107}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11268]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13725]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13726]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13727]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6730]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6736]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6842]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=113469}}
 
−
{{#set: left-end-position=104152}}
 
−
{{#set: centisome-position=25.631485    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8088

  • common-name:
    • 1-linoleoyl-2-oleoyl-phosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • rtazwrzkfstmoy-nmsvecgzsa-n
  • molecular-weight:
    • 784.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8088&oldid=137896"