Difference between revisions of "CPD-8089"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite CPD-8089 == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8089 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lpdgucimnbnwej-bxzvqshesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 782.092 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8330]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8321]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=782.092}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8089
- common-name:
- 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- lpdgucimnbnwej-bxzvqshesa-n
- molecular-weight:
- 782.092
