Difference between revisions of "CPD-8091"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * smiles: ** c([o-])(=o)c(cccc(c([o-])=o...") |
(Created page with "Category:metabolite == Metabolite CPD-8091 == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8091 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleoyl-2-linoleoyl-phosphatidylcholine |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gdwulugdxghjij-vjhnmzkjsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 784.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8322]] |
| + | * [[RXN-8326]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8327]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=784.107}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-8091
- common-name:
- 1-oleoyl-2-linoleoyl-phosphatidylcholine
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- gdwulugdxghjij-vjhnmzkjsa-n
- molecular-weight:
- 784.107
