Difference between revisions of "CPD-8091"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-2-Diglycerides == * common-name: ** a 1,2-diglyceride == Reaction(s) known to consume the compound == * 2-ACYLGLYCEROL-O-ACYLTRANSFER...") |
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * smiles: ** c([o-])(=o)c(cccc(c([o-])=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-α-amino-ε-keto-pimelate |
| + | * smiles: | ||
| + | ** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+] | ||
| + | * inchi-key: | ||
| + | ** ukcsfklwnhubdy-bypyzucnsa-m | ||
| + | * molecular-weight: | ||
| + | ** 188.16 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-α-amino-ε-keto-pimelate}} |
| + | {{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}} | ||
| + | {{#set: molecular-weight=188.16}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE
- common-name:
- l-α-amino-ε-keto-pimelate
- smiles:
- c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
- inchi-key:
- ukcsfklwnhubdy-bypyzucnsa-m
- molecular-weight:
- 188.16
