Difference between revisions of "CPD-8093"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10490 == * common-name: ** n-ethylglycine * smiles: ** ccncc(=o)[o-] * inchi-key: ** ypiggyhfmkjnkv-uhfffaoysa-m * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite CPD-8093 == * common-name: ** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=c...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8093 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hzgavpneghqjid-unbchyimsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 780.076 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8325]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8324]] | ||
| + | * [[RXN-8329]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-linoleoyl-2-α-linolenoyl-phosphatidylcholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hzgavpneghqjid-unbchyimsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=780.076}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-8093
- common-name:
- 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine
- smiles:
- cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- hzgavpneghqjid-unbchyimsa-n
- molecular-weight:
- 780.076
