Difference between revisions of "CPD-8093"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.142-RXN 2.4.1.142-RXN] == * direction: ** left-to-right * common-name: ** chitobiosyldiphosph...")
(Created page with "Category:metabolite == Metabolite CPD-8093 == * common-name: ** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=c...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.142-RXN 2.4.1.142-RXN] ==
+
== Metabolite CPD-8093 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** chitobiosyldiphosphodolichol β-mannosyltransferase
+
** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1.142 ec-2.4.1.142]
+
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GDP-MANNOSE]][c] '''+''' 1 [[NN-DIACETYLCHITOBIOSYLDIPHOSPHODOLICHO]][c] '''=>''' 1 [[ALPHA-D-MANNOSYLCHITOBIO]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c]
+
** hzgavpneghqjid-unbchyimsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ14919]]
+
** 780.076
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8325]]
−
* Gene: [[SJ14920]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-8324]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8329]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=1-linoleoyl-2-α-linolenoyl-phosphatidylcholine}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=hzgavpneghqjid-unbchyimsa-n}}
−
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]], protein N-glycosylation initial phase (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]
+
{{#set: molecular-weight=780.076}}
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13866 13866]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04502 R04502]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=chitobiosyldiphosphodolichol β-mannosyltransferase}}
 
−
{{#set: ec-number=ec-2.4.1.142}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8093

  • common-name:
    • 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • hzgavpneghqjid-unbchyimsa-n
  • molecular-weight:
    • 780.076

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8093&oldid=139681"