Difference between revisions of "CPD-8093"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCV3 TCV3] == * direction: ** reversible == Reaction formula == * 1.0 NITRATE[C_c] '''<=>''' 1....") |
(Created page with "Category:metabolite == Metabolite CPD-8093 == * common-name: ** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=c...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8093 == |
− | * | + | * common-name: |
− | ** | + | ** 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine |
− | + | * smiles: | |
− | * | + | ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
− | == | + | * inchi-key: |
− | + | ** hzgavpneghqjid-unbchyimsa-n | |
− | + | * molecular-weight: | |
− | + | ** 780.076 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-8325]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | ** | + | * [[RXN-8324]] |
− | * | + | * [[RXN-8329]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1-linoleoyl-2-α-linolenoyl-phosphatidylcholine}} | |
− | ** | + | {{#set: inchi-key=inchikey=hzgavpneghqjid-unbchyimsa-n}} |
− | + | {{#set: molecular-weight=780.076}} | |
− | * | ||
− | |||
− | == | ||
− | |||
− | * | ||
− | * | ||
− | == | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-8093
- common-name:
- 1-linoleoyl-2-α-linolenoyl-phosphatidylcholine
- smiles:
- cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- hzgavpneghqjid-unbchyimsa-n
- molecular-weight:
- 780.076