Difference between revisions of "CPD-8120"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15242 == * transcription-direction: ** positive * right-end-position: ** 6971 * left-end-position: ** 6381 * centisome-position: ** 80.31467 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * inchi-key: ** hobaelrkjckhqd-qneb...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8120 == |
− | * | + | * common-name: |
− | ** | + | ** di-homo-γ-linolenate |
− | * | + | * smiles: |
− | ** | + | ** cccccc=ccc=ccc=cccccccc(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** hobaelrkjckhqd-qnebeihssa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 305.479 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-13435]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=di-homo-γ-linolenate}} | |
− | + | {{#set: inchi-key=inchikey=hobaelrkjckhqd-qnebeihssa-m}} | |
− | {{#set: | + | {{#set: molecular-weight=305.479}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-8120
- common-name:
- di-homo-γ-linolenate
- smiles:
- cccccc=ccc=ccc=cccccccc(=o)[o-]
- inchi-key:
- hobaelrkjckhqd-qnebeihssa-m
- molecular-weight:
- 305.479