Difference between revisions of "CPD-8120"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21005 == * transcription-direction: ** positive * right-end-position: ** 245895 * left-end-position: ** 233258 * centisome-position: ** 38.340523...") |
(Created page with "Category:metabolite == Metabolite DEHYDROQUINATE == * common-name: ** 3-dehydroquinate * smiles: ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) * inchi-key: ** wvmwzwgzraxubk-sytvj...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DEHYDROQUINATE == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-dehydroquinate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** wvmwzwgzraxubk-sytvjdicsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 189.144 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | + | * [[3-DEHYDROQUINATE-SYNTHASE-RXN]] | |
| − | + | * [[RXN-10032]] | |
| − | * [[ | + | * [[RXN-7967]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=3-dehydroquinate}} |
| − | == | + | {{#set: inchi-key=inchikey=wvmwzwgzraxubk-sytvjdicsa-m}} |
| − | + | {{#set: molecular-weight=189.144}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite DEHYDROQUINATE
- common-name:
- 3-dehydroquinate
- smiles:
- c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1)
- inchi-key:
- wvmwzwgzraxubk-sytvjdicsa-m
- molecular-weight:
- 189.144
