Difference between revisions of "CPD-8120"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEHYDROQUINATE == * common-name: ** 3-dehydroquinate * smiles: ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) * inchi-key: ** wvmwzwgzraxubk-sytvj...") |
(Created page with "Category:metabolite == Metabolite Cytochrome-c-N-O-methyl-arginines == * common-name: ** [cytochrome c]-nω-methyl-arginine == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cytochrome-c-N-O-methyl-arginines == |
* common-name: | * common-name: | ||
| − | ** | + | ** [cytochrome c]-nω-methyl-arginine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.1.1.124-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[cytochrome c]-nω-methyl-arginine}} |
| − | |||
| − | |||
Revision as of 14:56, 5 January 2021
Contents
Metabolite Cytochrome-c-N-O-methyl-arginines
- common-name:
- [cytochrome c]-nω-methyl-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "cytochrome c]-nω-methyl-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
