Difference between revisions of "CPD-8120"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite URATE == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key: ** lehotffkmjeonl-uhfffaoysa-n * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite CPD-178 == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-178 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-myo-inositol (3,4,5,6)-tetrakisphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mrvyfoanpdtyby-uzaagftcsa-f |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 492.013 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.1.134-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=492.013}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-178
- common-name:
- d-myo-inositol (3,4,5,6)-tetrakisphosphate
- smiles:
- c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- mrvyfoanpdtyby-uzaagftcsa-f
- molecular-weight:
- 492.013
