Difference between revisions of "CPD-8122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE == * smiles: ** c([n+])cop([o-])(=o)occ(o)co[r] * common-name: ** 1-alkyl-sn-glycero-3-phosphoethano...")
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ==
+
== Metabolite CPD-15689 ==
 +
* common-name:
 +
** (2e,5e)-dodeca-2,5-dienoyl-coa
 
* smiles:
 
* smiles:
** c([n+])cop([o-])(=o)occ(o)co[r]
+
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* common-name:
+
* inchi-key:
** 1-alkyl-sn-glycero-3-phosphoethanolamine
+
** zsjrxhrcabosnc-uovvplbnsa-j
 +
* molecular-weight:
 +
** 941.776
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14801]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LPLPS1AGPE180h]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
+
{{#set: common-name=(2e,5e)-dodeca-2,5-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-uovvplbnsa-j}}
 +
{{#set: molecular-weight=941.776}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-15689

  • common-name:
    • (2e,5e)-dodeca-2,5-dienoyl-coa
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zsjrxhrcabosnc-uovvplbnsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality