Difference between revisions of "CPD-8122"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15689 == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-phospho-β-d-ribosylamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** skcbpevygoqgjn-txicztdvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 228.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[GLYRIBONUCSYN-RXN]] |
| + | * [[PRPPAMIDOTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PRPPAMIDOTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-phospho-β-d-ribosylamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.118}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite 5-P-BETA-D-RIBOSYL-AMINE
- common-name:
- 5-phospho-β-d-ribosylamine
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
- inchi-key:
- skcbpevygoqgjn-txicztdvsa-m
- molecular-weight:
- 228.118
