Difference between revisions of "CPD-8122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * inc...")
(Created page with "Category:metabolite == Metabolite CPD-8122 == * common-name: ** molybdopterin adenine dinucleotide * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-P-BETA-D-RIBOSYL-AMINE ==
+
== Metabolite CPD-8122 ==
 
* common-name:
 
* common-name:
** 5-phospho-β-d-ribosylamine
+
** molybdopterin adenine dinucleotide
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ5(o[ch]4(nc6(n=c(nc(=o)c(n[ch]4c(=c5[s-])s)=6)n))))(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** skcbpevygoqgjn-txicztdvsa-m
+
** xjxfaxluokqpaq-yprlvjtjsa-k
 
* molecular-weight:
 
* molecular-weight:
** 228.118
+
** 721.529
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYRIBONUCSYN-RXN]]
+
* [[RXN-8348]]
* [[PRPPAMIDOTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRPPAMIDOTRANS-RXN]]
+
* [[RXN-8344]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-β-d-ribosylamine}}
+
{{#set: common-name=molybdopterin adenine dinucleotide}}
{{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}}
+
{{#set: inchi-key=inchikey=xjxfaxluokqpaq-yprlvjtjsa-k}}
{{#set: molecular-weight=228.118}}
+
{{#set: molecular-weight=721.529}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-8122

  • common-name:
    • molybdopterin adenine dinucleotide
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ5(o[ch]4(nc6(n=c(nc(=o)c(n[ch]4c(=c5[s-])s)=6)n))))(=o)[o-]
  • inchi-key:
    • xjxfaxluokqpaq-yprlvjtjsa-k
  • molecular-weight:
    • 721.529

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality