Difference between revisions of "CPD-8122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...")
(Created page with "Category:metabolite == Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE == * smiles: ** c([n+])cop([o-])(=o)occ(o)co[r] * common-name: ** 1-alkyl-sn-glycero-3-phosphoethano...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GUANOSINE-5DP-3DP ==
+
== Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ==
 +
* smiles:
 +
** c([n+])cop([o-])(=o)occ(o)co[r]
 
* common-name:
 
* common-name:
** ppgpp
+
** 1-alkyl-sn-glycero-3-phosphoethanolamine
* smiles:
 
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** bufllcufnheseh-uuokfmhzsa-i
 
* molecular-weight:
 
** 598.123
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GBDP]]
 
* [[PPGPPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GBDP]]
+
* [[LPLPS1AGPE180h]]
* [[GDPPYPHOSKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ppgpp}}
+
{{#set: common-name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
 
{{#set: molecular-weight=598.123}}
 

Revision as of 18:57, 14 January 2021

Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE

  • smiles:
    • c([n+])cop([o-])(=o)occ(o)co[r]
  • common-name:
    • 1-alkyl-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality