Difference between revisions of "CPD-8123"

Revision as of 11:14, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17371 ==
+== Metabolite FE+2 ==
 * common-name:
-** 18-hydroxylinoleoyl-coa
+** fe2+
 * smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** [fe++]
 * inchi-key:
-** hjegylshikpenr-daxvlclxsa-j
+** cwynvvgooaeacu-uhfffaoysa-n
 * molecular-weight:
-** 1041.936
+** 55.847
 == Reaction(s) known to consume the compound ==
-* [[RXN-16118]]
+* [[ExchangeSeed-FE+2]]
+* [[FE2GTPabc]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[PROTOHEMEFERROCHELAT-RXN]]
+* [[RXN-17518]]
+* [[RXN0-1483]]
+* [[SIROHEME-FERROCHELAT-RXN]]
+* [[TransportSeed-FE+2]]
 == Reaction(s) known to produce the compound ==
+* [[ExchangeSeed-FE+2]]
+* [[FE2GTPabc]]
+* [[FESO3OXI-RXN]]
+* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[PROTOHEMEFERROCHELAT-RXN]]
+* [[RXN-15598]]
+* [[RXN-17523]]
+* [[TransportSeed-FE+2]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=18-hydroxylinoleoyl-coa}}
+{{#set: common-name=fe2+}}
-{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
+{{#set: inchi-key=inchikey=cwynvvgooaeacu-uhfffaoysa-n}}
-{{#set: molecular-weight=1041.936}}
+{{#set: molecular-weight=55.847}}