Difference between revisions of "CPD-8124"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18351 == * common-name: ** 1-cis-vaccenoyl-2-palmitoleoyl phosphatidate * smiles: ** ccccccc=ccccccccccc(occ(oc(=o)cccccccc=ccccccc)c...") |
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DGMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dgmp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ltfmzdnnppeqng-kvqbguixsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 345.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ATDGM]] | ||
| + | * [[DMPH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DGTD]] |
| − | * [[RXN- | + | * [[DMPH]] |
| + | * [[RXN-14208]] | ||
| + | * [[RXN-14218]] | ||
| + | * [[RXN0-385]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dgmp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=345.208}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite DGMP
- common-name:
- dgmp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ltfmzdnnppeqng-kvqbguixsa-l
- molecular-weight:
- 345.208
